CymitQuimica logo

CAS 59020-06-3

:

Trimethyl(4-pyridyl)tin

Description:
Trimethyl(4-pyridyl)tin, with the CAS number 59020-06-3, is an organotin compound characterized by the presence of a tin atom bonded to three methyl groups and one 4-pyridyl group. This compound typically exhibits a white to light yellow solid appearance and is soluble in organic solvents such as dichloromethane and toluene, but is generally insoluble in water. The presence of the pyridyl group imparts unique chemical properties, including potential coordination with various ligands and catalytic activity in certain reactions. Trimethyl(4-pyridyl)tin is often studied for its applications in organic synthesis, materials science, and as a potential biocide. However, like many organotin compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its reactivity can be influenced by the presence of functional groups in its environment, making it a subject of interest in both academic and industrial research. Safety precautions are essential when working with this compound due to its potential toxicity.
Formula:C8H13NSn
InChI:InChI=1/C5H4N.3CH3.Sn/c1-2-4-6-5-3-1;;;;/h2-5H;3*1H3;/rC8H13NSn/c1-10(2,3)8-4-6-9-7-5-8/h4-7H,1-3H3
SMILES:C[Sn](C)(C)c1ccncc1
Synonyms:
  • 4-(Trimethylstannyl)pyridine
  • Pyridine, 4-(Trimethylstannyl)-
  • 4-(Trimethylstannanyl)Pyridine
Found 1 products.