CymitQuimica logo

CAS 59020-44-9

:

4-Phenylthiazole-2-carboxylic acid

Description:
4-Phenylthiazole-2-carboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a phenyl group attached to the thiazole ring, contributing to its aromatic properties. The carboxylic acid functional group (-COOH) at the second position of the thiazole ring imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The presence of the phenyl group enhances its potential for interactions in biological systems, possibly influencing its solubility and reactivity. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Additionally, its unique structure may exhibit specific biological activities, making it a subject of research in pharmacology and biochemistry. As with many organic compounds, its properties can be influenced by factors such as pH, temperature, and solvent interactions.
Formula:C10H7NO2S
InChI:InChI=1/C10H7NO2S/c12-10(13)9-11-8(6-14-9)7-4-2-1-3-5-7/h1-6H,(H,12,13)
InChI key:ORSGNNVYFOPYKB-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1csc(C(=O)O)n1
Synonyms:
  • 4-Phenyl-1,3-thiazole-2-carboxylic acid
Found 4 products.