CymitQuimica logo

CAS 59128-08-4

:

(8-methylimidazo[1,2-a]pyridin-2-yl)acetic acid

Description:
(8-Methylimidazo[1,2-a]pyridin-2-yl)acetic acid is a chemical compound that belongs to the class of heterocyclic aromatic compounds, specifically imidazo[1,2-a]pyridines. It is characterized by the presence of an imidazole ring fused to a pyridine ring, with a methyl group at the 8-position and an acetic acid functional group attached at the 2-position of the imidazole. This compound is of interest due to its potential biological activity and has been studied for its role in mutagenicity and carcinogenicity, particularly in relation to cooked meats. The presence of the acetic acid moiety may influence its solubility and reactivity. Its molecular structure contributes to its chemical properties, including its ability to participate in various chemical reactions, such as acylation and esterification. The compound is typically analyzed using techniques such as chromatography and spectroscopy to determine its purity and concentration in research settings. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-7-3-2-4-12-6-8(5-9(13)14)11-10(7)12/h2-4,6H,5H2,1H3,(H,13,14)
InChI key:YCTZVTJSUDRKGV-UHFFFAOYSA-N
SMILES:Cc1cccn2cc(CC(=O)O)nc12
Found 4 products.