CAS 5928-51-8
:3-(2-Thienyl)propanoic acid
Description:
3-(2-Thienyl)propanoic acid, with the CAS number 5928-51-8, is an organic compound characterized by its thienyl group, which is a five-membered aromatic ring containing sulfur. This compound features a propanoic acid moiety, indicating the presence of a carboxylic acid functional group (-COOH) attached to a three-carbon chain. The thienyl group contributes to the compound's aromaticity and can influence its chemical reactivity and interactions. Typically, compounds like 3-(2-Thienyl)propanoic acid exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the thienyl ring may enhance lipophilicity. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activities and applications in organic synthesis. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups in a given reaction context.
Formula:C7H5BrN2
InChI:InChI=1/C7H5BrN2/c8-6-2-1-5-4-9-10-7(5)3-6/h1-4H,(H,9,10)
SMILES:c1cc(cc2c1c[nH]n2)Br
Synonyms:- 2-Thiophenepropanoic acid
- 3-Thien-2-Ylpropanoic Acid
- 3-(Thiophen-2-Yl)Propanoic Acid
- 1-(3,4-Dimethoxyphenyl)-3-(Diphenylmethyl)Urea
- 3-Thiophen-2-Ylpropanoate
- 3-(2-Thienyl)Propionic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-(2-Thienyl)Propionic Acid
CAS:3-(2-Thienyl)Propionic AcidFormula:C7H8O2SPurity:98%Color and Shape:SolidMolecular weight:156.23-(2-Thienyl)propanoic acid
CAS:Formula:C7H8O2SPurity:97%Color and Shape:SolidMolecular weight:156.20222-Thiophenepropionic acid
CAS:3-(2-Thienyl)propionic AcidFormula:C7H8O2SPurity:97%Molecular weight:156.23-(2-Thienyl)propionic acid
CAS:Formula:C7H8O2SPurity:97%Color and Shape:Solid, White to beige crystals or needlesMolecular weight:156.2Eprosartan Related Compound B (3-(thiophen-2-yl)propanoic acid) (DISCONTINUED)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C7H8O2SColor and Shape:White Beige SolidMolecular weight:156.0245







