CymitQuimica logo

CAS 593-94-2

:

Dibromoiodomethane

Description:
Dibromoiodomethane, with the CAS number 593-94-2, is an organic compound characterized by its molecular formula CBr2I. It is a halogenated methane derivative, featuring two bromine atoms and one iodine atom attached to a single carbon atom. This compound typically appears as a colorless to pale yellow liquid and is known for its high density and relatively low volatility. Dibromoiodomethane is soluble in organic solvents but has limited solubility in water. It is primarily used in organic synthesis and as a reagent in various chemical reactions, particularly in the preparation of other halogenated compounds. The presence of multiple halogens in its structure contributes to its reactivity, making it useful in substitution reactions. Additionally, dibromoiodomethane is of interest in the field of medicinal chemistry and material science due to its unique properties. However, handling this compound requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures in laboratory settings.
Formula:CHBr2I
InChI:InChI=1S/CHBr2I/c2-1(3)4/h1H
InChI key:InChIKey=SZVSEQHMMFKGEI-UHFFFAOYSA-N
SMILES:C(Br)(Br)I
Synonyms:
  • Dibromoiodomethane
  • Methane, Dibromoiodo-
Found 5 products.