CAS 5930-93-8
:Nitropyrrolecarboxylicacid
Description:
Nitropyrrolecarboxylic acid, identified by its CAS number 5930-93-8, is a chemical compound that features a pyrrole ring substituted with both a nitro group and a carboxylic acid group. This compound typically exhibits characteristics common to both aromatic and heterocyclic compounds, including potential acidity due to the carboxylic acid functional group and reactivity associated with the nitro group. The presence of these functional groups can influence its solubility, stability, and reactivity in various chemical reactions. Nitropyrrolecarboxylic acid may be utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in electrophilic and nucleophilic reactions. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. As with many nitro-substituted compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns.
Formula:C5H4N2O4
InChI:InChI=1/C5H4N2O4/c8-5(9)4-1-3(2-6-4)7(10)11/h1-2,6H,(H,8,9)
SMILES:c1c(c[nH]c1C(=O)O)N(=O)=O
Synonyms:- 4-Nitropyrrole-2-carboxylic acid hydrate
- N-(4-fluorobenzyl)-2-(4-fluorophenyl)-3-[(2-methylphenyl)carbonyl]-1,3-thiazolidine-4-carboxamide
- 4-nitro-1H-pyrrole-2-carboxylate
- 4-nitro-1H-pyrrole-2-carboxylic acid
- Nitropyrrolecarboxylicacid
- 4-NITROPYRROLE-2-CARBOXYLIC ACID
- 4-nitro-1H-pyrrole-2-carboxylic acid hydrate
- 1H-Pyrrole-2-carboxylic acid, 4-nitro-
- 4-Nitropyrrole-2-carboxylicAcidHydrate>
- 4-Nitro-1H-pyrrol-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Nitropyrrole-2-carboxylic Acid
CAS:Formula:C5H4N2O4Purity:>99.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:156.104-Nitro-1H-pyrrole-2-carboxylic acid
CAS:4-Nitro-1H-pyrrole-2-carboxylic acidFormula:C5H4N2O4Purity:99%Molecular weight:156.14-Nitro-1H-pyrrole-2-carboxylic acid
CAS:Formula:C5H4N2O4Purity:98%Color and Shape:SolidMolecular weight:156.09634-Nitro-1H-pyrrole-2-carboxylic acid
CAS:Formula:C5H4N2O4Purity:98%Color and Shape:White to very pale reddish yellow powderMolecular weight:156.0974-Nitro-1H-pyrrole-2-carboxylic acid
CAS:4-Nitro-1H-pyrrole-2-carboxylic acid is an amide derivative. It has acaricidal activity against ticks and insects, as well as a patent for use as a virus inhibitor. 4-Nitro-1H-pyrrole-2-carboxylic acid has been shown to be effective in treating vaginalis in insects and is also used to protect crops from insect infestation. 4-Nitro-1H-pyrrole-2-carboxylic acid is an amidino compound that contains a nitro group on the nitrogen atom of the amidino group. This nitro group is responsible for its antiacaridal activity against ticks and insects.Formula:C5H4N2O4Purity:Min. 95%Molecular weight:156.1 g/mol




