CymitQuimica logo

CAS 593960-11-3

:

N-[5-[4-Chloro-3-[[(2-hydroxyethyl)amino]sulfonyl]phenyl]-4-methyl-2-thiazolyl]acetamide

Description:
N-[5-[4-Chloro-3-[[(2-hydroxyethyl)amino]sulfonyl]phenyl]-4-methyl-2-thiazolyl]acetamide, with CAS number 593960-11-3, is a synthetic organic compound characterized by its complex structure, which includes a thiazole ring, a sulfonamide group, and an acetamide moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of hydroxyl and amino functional groups, which can engage in hydrogen bonding. The chloro and thiazole substituents may contribute to its biological activity, potentially influencing its interaction with biological targets. It is often studied for its pharmacological properties, particularly in the context of drug development, where its efficacy and safety profiles are evaluated. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it a versatile compound in medicinal chemistry. As with many synthetic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C14H16ClN3O4S2
InChI:InChI=1S/C14H16ClN3O4S2/c1-8-13(23-14(17-8)18-9(2)20)10-3-4-11(15)12(7-10)24(21,22)16-5-6-19/h3-4,7,16,19H,5-6H2,1-2H3,(H,17,18,20)
InChI key:JFVNFXCESCXMBC-UHFFFAOYSA-N
SMILES:CC1=C(SC(=N1)NC(=O)C)C2=CC(=C(C=C2)Cl)S(=O)(=O)NCCO
Synonyms:
  • Pik 93
Found 7 products.