CymitQuimica logo

CAS 594823-67-3

:

3-Bromophenylboronic acid pinacol ester

Description:
3-Bromophenylboronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group and a bromophenyl moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethyl acetate. The pinacol ester formation enhances the stability of the boronic acid, making it more suitable for various synthetic applications, particularly in cross-coupling reactions like Suzuki-Miyaura coupling. The bromine atom on the phenyl ring serves as a useful handle for further functionalization, allowing for the introduction of diverse substituents. Additionally, the compound exhibits reactivity typical of boronic acids, such as the ability to form complexes with diols and participate in nucleophilic addition reactions. Its applications are significant in medicinal chemistry and materials science, where it can be utilized in the synthesis of complex organic molecules and polymers. Proper handling and storage are essential due to its reactivity and potential environmental impact.
Formula:C12H16BBrO2
InChI:InChI=1S/C12H16BBrO2/c1-11(2)12(3,4)16-13(15-11)9-6-5-7-10(14)8-9/h5-8H,1-4H3
InChI key:FHCWGLQDAMYXJS-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)Br
Synonyms:
  • 3-Bromo-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-yl)benzene
Found 5 products.