CAS 5950-34-5
:Aziridinecarboxylicacidmethylester; 96%
Description:
Aziridinecarboxylic acid methyl ester, with the CAS number 5950-34-5, is a chemical compound characterized by its aziridine ring structure, which is a three-membered cyclic amine. This compound features a carboxylic acid functional group and a methyl ester, contributing to its reactivity and potential applications in organic synthesis. Typically, aziridine derivatives are known for their strain due to the small ring size, which can lead to increased reactivity, particularly in nucleophilic and electrophilic reactions. The presence of the ester group enhances its solubility in organic solvents and may facilitate further chemical modifications. Aziridinecarboxylic acid methyl ester is often utilized in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals, due to its ability to serve as a building block in various chemical reactions. As with many aziridine compounds, safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C4H7NO2
InChI:InChI=1/C4H7NO2/c1-7-4(6)3-2-5-3/h3,5H,2H2,1H3
SMILES:COC(=O)C1CN1
Synonyms:- Aziridine-2-carboxylic acid methyl ester
- Methyl Aziridine-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl Aziridine-2-carboxylate (stabilized with HQ)
CAS:Formula:C4H7NO2Purity:>97.0%(GC)(T)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:101.11Methyl aziridine-2-carboxylate
CAS:Methyl aziridine-2-carboxylateFormula:C4H7NO2Purity:97%Molecular weight:101.1Methyl Aziridine-2-carboxylate
CAS:Formula:C4H7NO2Purity:97%Color and Shape:LiquidMolecular weight:101.1039Methyl aziridine-2-carboxylate
CAS:Methyl aziridine-2-carboxylateFormula:C4H7NO2Purity:97%Molecular weight:101.1Methyl aziridine-2-carboxylate
CAS:Purity:97%Color and Shape:Liquid (Oil)Molecular weight:101.1050034Methyl Aziridine-2-carboxylate
CAS:Controlled ProductStability Volatile
Applications METHYL AZIRIDINE-2-CARBOXYLATE (cas# 5950-34-5) is a useful research chemical.Formula:C4H7NO2Color and Shape:NeatMolecular weight:101.1





