CymitQuimica logo

CAS 595597-00-5

:

tert-butyl tetrahydro-2H-thiopyran-4-ylcarbamate

Description:
Tert-butyl tetrahydro-2H-thiopyran-4-ylcarbamate is a chemical compound characterized by its unique structure, which includes a thiopyran ring and a carbamate functional group. This compound typically exhibits properties associated with both cyclic and acyclic structures, contributing to its potential applications in organic synthesis and medicinal chemistry. The presence of the tert-butyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the thiopyran moiety can participate in various chemical reactions, making it a versatile intermediate in synthetic pathways. The compound's stability and reactivity can be affected by factors such as temperature, pH, and the presence of other reagents. As with many carbamates, it may also exhibit biological activity, which could be of interest in pharmacological research. Overall, tert-butyl tetrahydro-2H-thiopyran-4-ylcarbamate represents a valuable compound for further exploration in both academic and industrial chemistry contexts.
Formula:C10H19NO2S
InChI:InChI=1/C10H19NO2S/c1-10(2,3)13-9(12)11-8-4-6-14-7-5-8/h8H,4-7H2,1-3H3,(H,11,12)
InChI key:IRZQBMIZGJSXFN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NC1CCSCC1)O
Synonyms:
  • tert-Butyl tetrahydro-2H-thiopyran-4-ylcarbamate
Found 4 products.