CAS 59577-32-1
:2-(4-methoxybenzyloxycarbonyloxyimino)-2-phenyl-acetonitril
Description:
2-(4-Methoxybenzyloxycarbonyloxyimino)-2-phenyl-acetonitrile, identified by its CAS number 59577-32-1, is a chemical compound that features a complex structure characterized by the presence of a nitrile functional group, an imine linkage, and a methoxy-substituted aromatic ring. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific substituents and their interactions. The presence of the methoxy group can influence its reactivity and polarity, while the nitrile group may impart certain chemical properties, such as the ability to participate in nucleophilic reactions. Additionally, the compound's structure suggests potential applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or applications would require further investigation. Overall, the characteristics of this compound are defined by its unique functional groups and structural features, which can influence its chemical behavior and potential uses in various fields.
Formula:C17H14N2O4
InChI:InChI=1/C17H14N2O4/c1-21-15-9-7-13(8-10-15)12-22-17(20)23-19-16(11-18)14-5-3-2-4-6-14/h2-10H,12H2,1H3
SMILES:COc1ccc(cc1)COC(=O)ON=C(C#N)c1ccccc1
Synonyms:- 2-(4-Methoxybenzyloxycarbonyloxyimino)-2-phenylacetonitrile
- [({[(4-Methoxybenzyl)Oxy]Carbonyl}Oxy)Imino](Phenyl)Acetonitrile
- Benzeneacetonitrile, α-[[[[(4-methoxyphenyl)methoxy]carbonyl]oxy]imino]- (9CI)
- 2-(4-methoxybenzyloxycarbonyloxyimino)-2-phenyl-acetonitril
- (Z)-N-((4-METHOXYBENZYLOXY)CARBONYLOXY) BENZIMIDOYL CYANIDE
- MOZ-ON
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(Z)-N-((4-METHOXYBENZYLOXY)CARBONYLOXY) BENZIMIDOYL CYANIDE
CAS:Formula:C17H14N2O4Molecular weight:310.3041
