CymitQuimica logo

CAS 59611-52-8

:

6-FLUORO-1,2,3,4-TETRAHYDROQUINOLINE

Description:
6-Fluoro-1,2,3,4-tetrahydroquinoline is a bicyclic organic compound characterized by a fused ring structure that includes a nitrogen atom. It features a fluorine substituent at the 6-position of the quinoline framework, which can influence its chemical reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to various bioactive compounds. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a valuable moiety in drug design. Additionally, 6-fluoro-1,2,3,4-tetrahydroquinoline may exhibit interesting properties such as fluorescence or specific interactions with biological targets, which can be explored in research settings. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C9H10FN
InChI:InChI=1S/C9H10FN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6,11H,1-2,5H2
InChI key:NECDDBBJVCNJNS-UHFFFAOYSA-N
SMILES:C1Cc2cc(ccc2NC1)F
Found 5 products.