CAS 59646-16-1

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole

Description:

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole is a heterocyclic organic compound characterized by its bicyclic structure, which consists of a pyrrole and an imidazole ring fused together. This compound typically exhibits a range of chemical properties due to the presence of nitrogen atoms in its rings, which can participate in hydrogen bonding and coordination with metal ions. It is generally a colorless to pale yellow solid at room temperature and may be soluble in polar organic solvents. The compound is of interest in medicinal chemistry and may exhibit biological activity, potentially serving as a scaffold for drug development. Its unique structure allows for various functionalizations, making it a versatile intermediate in organic synthesis. Additionally, the presence of multiple nitrogen atoms can influence its reactivity and stability, making it a subject of study in both theoretical and applied chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₈N₂

InChI: InChI=1/C6H8N2/c1-2-6-7-3-5-8(6)4-1/h3,5H,1-2,4H2

SMILES: C1Cc2nccn2C1

Synonyms:

• 5H-pyrrolo[1,2-a]imidazole, 6,7-dihydro-

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole

CAS: 59646-16-1

Formula: C₆H₈N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 108.1411

Ref: IN-DA00ECQA

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole

CAS: 59646-16-1

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole

Purity: 95%

Molecular weight: 108.14g/mol

Ref: 54-OR42179

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole

CAS: 59646-16-1

Formula: C₆H₈N₂

Purity: 97%

Molecular weight: 108.144

Ref: 10-F069129

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole

CAS: 59646-16-1

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole is a drug target that belongs to the class of anesthetics. It has been shown to have a protective effect against CNS damage in rats with experimental stroke. 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole also has a wide range of other effects including antiarrhythmic, antihypertensive, and antianginal properties. It can be used as an anticonvulsant or muscle relaxant and as a diuretic agent for edema and hypertension. 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole binds to the chlorine atom in the active site of the enzyme skeletal muscle chloride channel (CLC). This prevents the channel from opening and chloride ions from passing through it

Formula: C₆H₈N₂

Purity: Min. 95%

Molecular weight: 108.14 g/mol

Ref: 3D-JCA64616