CAS 59646-16-1
:6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole
Description:
6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole is a heterocyclic organic compound characterized by its bicyclic structure, which consists of a pyrrole and an imidazole ring fused together. This compound typically exhibits a range of chemical properties due to the presence of nitrogen atoms in its rings, which can participate in hydrogen bonding and coordination with metal ions. It is generally a colorless to pale yellow solid at room temperature and may be soluble in polar organic solvents. The compound is of interest in medicinal chemistry and may exhibit biological activity, potentially serving as a scaffold for drug development. Its unique structure allows for various functionalizations, making it a versatile intermediate in organic synthesis. Additionally, the presence of multiple nitrogen atoms can influence its reactivity and stability, making it a subject of study in both theoretical and applied chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H8N2
InChI:InChI=1/C6H8N2/c1-2-6-7-3-5-8(6)4-1/h3,5H,1-2,4H2
SMILES:C1Cc2nccn2C1
Synonyms:- 5H-pyrrolo[1,2-a]imidazole, 6,7-dihydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole
CAS:6,7-Dihydro-5H-pyrrolo[1,2-a]imidazoleFormula:C6H8N2Purity:95%Color and Shape:colourless - yellow LiquidMolecular weight:108.141115H-Pyrrolo[1,2-a]imidazole, 6,7-dihydro-
CAS:Formula:C6H8N2Purity:98%Color and Shape:SolidMolecular weight:108.14116,7-Dihydro-5H-pyrrolo[1,2-a]imidazole
CAS:6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole is a drug target that belongs to the class of anesthetics. It has been shown to have a protective effect against CNS damage in rats with experimental stroke. 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole also has a wide range of other effects including antiarrhythmic, antihypertensive, and antianginal properties. It can be used as an anticonvulsant or muscle relaxant and as a diuretic agent for edema and hypertension. 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole binds to the chlorine atom in the active site of the enzyme skeletal muscle chloride channel (CLC). This prevents the channel from opening and chloride ions from passing through it
Formula:C6H8N2Purity:Min. 95%Molecular weight:108.14 g/mol6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole
CAS:6,7-Dihydro-5H-pyrrolo[1,2-a]imidazoleFormula:C6H8N2Purity:98%Molecular weight:108.14




