CAS 59653-37-1
:methyl 8-methyl-5,6,8,8a-tetrahydro-1H,4aH-1,6-epoxypyrano[3,4-c]pyran-4-carboxylate
Description:
Methyl 8-methyl-5,6,8,8a-tetrahydro-1H,4aH-1,6-epoxypyrano[3,4-c]pyran-4-carboxylate, identified by its CAS number 59653-37-1, is a chemical compound characterized by its complex bicyclic structure that includes a pyran and pyranone moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and an epoxide functional group, which contributes to its reactivity. The presence of a carboxylate ester group suggests potential applications in organic synthesis and medicinal chemistry, as esters are often involved in various chemical reactions, including hydrolysis and transesterification. The methyl substituent at the 8-position may influence the compound's solubility and biological activity. Overall, this compound's unique structural features may provide interesting properties for research in fields such as natural product chemistry and pharmacology, although specific biological activities and applications would require further investigation.
Formula:C11H14O5
InChI:InChI=1/C11H14O5/c1-5-9-6-3-8(15-5)16-11(9)14-4-7(6)10(12)13-2/h4-6,8-9,11H,3H2,1-2H3
SMILES:CC1C2C3CC(O1)OC2OC=C3C(=O)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Sarracenin
CAS:Sarracenin is a natural product. Sarracenin shows cytotoxic activities against tumor cells.Formula:C11H14O5Purity:99.47% - 99.69%Color and Shape:SolidMolecular weight:226.23Sarracenin
CAS:Sarracenin is a complex phytochemical compound, which is derived from the Sarracenia genus of carnivorous plants, commonly known as the pitcher plants. The primary source of this compound stems from the specialized glandular structures of these plants, where it is believed to play a role in the plant's defense mechanisms against herbivory and pathogen attack. The mode of action of Sarracenin primarily involves modulation of biochemical pathways through its interaction with specific cellular receptors, potentially influencing antioxidant and anti-inflammatory responses at the molecular level.Formula:C11H14O5Purity:Min. 95%Molecular weight:226.23 g/mol




