CAS 5968-90-1: 9-pentofuranosyl-3,9-dihydro-1H-purine-2,6-dione hydrate
Description:9-Pentofuranosyl-3,9-dihydro-1H-purine-2,6-dione hydrate, commonly known as a nucleoside analog, is characterized by its structural components that include a purine base and a pentofuranosyl sugar moiety. This compound typically exhibits properties associated with nucleosides, such as the ability to participate in hydrogen bonding due to the presence of functional groups like carbonyls and hydroxyls. The hydrate form indicates that it contains water molecules in its crystalline structure, which can influence its solubility and stability. As a purine derivative, it may play a role in biological processes, potentially acting as a substrate or inhibitor in nucleic acid metabolism. The compound's CAS number, 5968-90-1, allows for its identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and biochemistry. Its unique structure may also confer specific pharmacological properties, making it of interest in drug development, particularly in antiviral or anticancer therapies.
Formula:C10H14N4O7
InChI:InChI=1/C10H12N4O6.H2O/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18;/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19);1H2
- Synonyms:
- Xanthosine dihydrate
