CAS 5968-90-1
:9-pentofuranosyl-3,9-dihydro-1H-purine-2,6-dione hydrate
Description:
9-Pentofuranosyl-3,9-dihydro-1H-purine-2,6-dione hydrate, commonly known as a nucleoside analog, is characterized by its structural components that include a purine base and a pentofuranosyl sugar moiety. This compound typically exhibits properties associated with nucleosides, such as the ability to participate in hydrogen bonding due to the presence of functional groups like carbonyls and hydroxyls. The hydrate form indicates that it contains water molecules in its crystalline structure, which can influence its solubility and stability. As a purine derivative, it may play a role in biological processes, potentially acting as a substrate or inhibitor in nucleic acid metabolism. The compound's CAS number, 5968-90-1, allows for its identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and biochemistry. Its unique structure may also confer specific pharmacological properties, making it of interest in drug development, particularly in antiviral or anticancer therapies.
Formula:C10H14N4O7
InChI:InChI=1/C10H12N4O6.H2O/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18;/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19);1H2
SMILES:C(C1C(C(C(n2cnc3c2nc(nc3O)O)O1)O)O)O.O
Synonyms:- Xanthosine dihydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Xanthosine dihydrate
CAS:Formula:C10H12N4O6·2H2OPurity:(TLC) ≥ 99.0%Color and Shape:White to off-white powderMolecular weight:320.26Xanthosine dihydrate
CAS:Xanthosine, made by some bacteria, is a purine metabolism intermediate, evolving from IMP to GMP.Formula:C10H16N4O8Purity:99.75%Color and Shape:SolidMolecular weight:320.26Xanthosine Dihydrate
CAS:Applications The deamination product of Guanosine. Potential biomarker for detecting radiation exposure. Used in the amplification of DNA isothermal strand displacement.
References Magasanik, B, et al.: J. Bio. Chem., 206, 83 (1954).Formula:C10H12N4O6·2H2OColor and Shape:NeatMolecular weight:320.256Xanthosine dihydrate
CAS:Controlled ProductXanthosine dihydrate is a crystalline polymorph of xanthosine. It has been shown to have anti-inflammatory effects in animal models and also inhibits the production of pro-inflammatory cytokines and nitric oxide. Xanthosine dihydrate binds to benzimidazole compounds and caffeine, which are involved in the inflammatory process. This drug also inhibits the production of nitric oxide and prostaglandins by inhibiting cyclooxygenase enzymes. Xanthosine dihydrate is a solute that can be used in cell culture experiments to study how cells respond to different concentrations of it.Formula:C10H12N4O6·2H2OPurity:Min. 99 Area-%Color and Shape:PowderMolecular weight:320.26 g/mol






