CAS 597-82-0
:Triphenyl phosphorothionate
Description:
Triphenyl phosphorothionate is an organophosphorus compound characterized by its structure, which includes a phosphorus atom bonded to three phenyl groups and a thiol group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its use as an insecticide and acaricide in agricultural applications, functioning as a neurotoxin that disrupts the normal functioning of the nervous system in pests. Triphenyl phosphorothionate exhibits moderate to low solubility in water but is more soluble in organic solvents, which influences its application in various formulations. The compound is also recognized for its potential environmental persistence and toxicity, necessitating careful handling and application to minimize risks to non-target organisms and ecosystems. Additionally, it can undergo hydrolysis and oxidation, leading to the formation of various degradation products. As with many organophosphates, safety precautions are essential when working with this substance due to its potential health hazards.
Formula:C18H15O3PS
InChI:InChI=1S/C18H15O3PS/c23-22(19-16-10-4-1-5-11-16,20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18/h1-15H
InChI key:InChIKey=IKXFIBBKEARMLL-UHFFFAOYSA-N
SMILES:P(OC1=CC=CC=C1)(OC2=CC=CC=C2)(OC3=CC=CC=C3)=S
Synonyms:- Ai3-08872
- Nsc 57867
- O,O,O-Triphenyl thiophosphate
- O,O,O-Triphenylphosphorothioate
- O,O,S-triphenyl phosphorothioate
- Phenyl phosphorothioate ((PhO)<sub>3</sub>PS)
- Phenyl phosphorothioate, (PhO)3PS
- Phosphorothioic acid, O,O,O-triphenyl ester
- T 309
- T 309 (antiwear additive)
- Thiophosphoric acid triphenyl ester
- Tppt
- Triphenoxyphosphine sulfide
- Triphenyl phosphorothioate
- Triphenyl phosphorothionate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Triphenylphosphorothionate
CAS:Controlled ProductTriphenylphosphorothionateFormula:C18H15O3PSPurity:95%Molecular weight:342.34Triphenyl Phosphorothionate
CAS:Controlled ProductFormula:C18H15O3PSPurity:95%Color and Shape:SolidMolecular weight:342.3487Triphenylphosphorothionate
CAS:Controlled ProductTriphenylphosphorothionateFormula:C18H15O3PSPurity:98%Color and Shape:SolidMolecular weight:342.35Triphenyl phosphorothioate
CAS:Controlled ProductFormula:C18H15O3PSColor and Shape:NeatMolecular weight:342.35Triphenyl Phosphorothioate
CAS:Controlled ProductFormula:C18H15O3PSColor and Shape:NeatMolecular weight:342.35Triphenyl phosphorothioate
CAS:Controlled ProductTriphenyl phosphorothioate is a glycol ester that is chemically stable and has a low boiling point. It is used as a lubricant in high-temperature environments and can be mixed with sodium citrate for sterilization. Triphenyl phosphorothioate is also used as an antiseptic and disinfectant in the form of its sodium salt, which contains the active ingredient, triphenyl phosphate. The reaction mechanism of this chemical compound involves the formation of hydroxyl groups from the two hydroxide ions that are generated by the hydrolysis of water molecules. The resulting molecule forms a covalent bond between the two sulfur atoms, creating a disulfide bond.
Formula:C18H15O3PSPurity:Min. 95%Color and Shape:White PowderMolecular weight:342.35 g/molTriphenyl-d15 Phosphorothioate
CAS:Controlled ProductFormula:C18D15O3PSColor and Shape:NeatMolecular weight:357.441







