CymitQuimica logo

CAS 59782-88-6

:

2,5-Dichloro-3-methylpyridine

Description:
2,5-Dichloro-3-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two chlorine atoms and a methyl group. Its molecular formula is C7H6Cl2N, indicating the presence of carbon, hydrogen, chlorine, and nitrogen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a distinct aromatic odor and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. 2,5-Dichloro-3-methylpyridine is primarily used in the synthesis of various pharmaceuticals and agrochemicals, serving as an intermediate in chemical reactions. It exhibits moderate toxicity, and appropriate safety measures should be taken when handling it, including the use of personal protective equipment. The compound's reactivity is influenced by the presence of the chlorine substituents, which can participate in nucleophilic substitution reactions, making it a valuable building block in organic synthesis.
Formula:C6H5Cl2N
InChI:InChI=1/C6H5Cl2N/c1-4-2-5(7)6(8)9-3-4/h2-3H,1H3
InChI key:HZOPYQZRWCJGDT-UHFFFAOYSA-N
SMILES:Cc1cc(c(Cl)nc1)Cl
Synonyms:
  • Pyridine, 2,5-dichloro-3-methyl-
  • 2,3-Dichloro-5-Methylpyridine
  • 2,5-Dichloro-3-Picoline
Found 4 products.