CAS 5980-31-4
:hexedine
Description:
Hexedine, with the CAS number 5980-31-4, is a chemical compound that belongs to the class of aliphatic amines. It is characterized by its structure, which typically includes a hexane backbone with amine functional groups. Hexedine is known for its potential applications in various fields, including pharmaceuticals and biochemistry, often serving as an intermediate in the synthesis of more complex molecules. The compound is generally colorless to pale yellow and may have a distinct odor. Its solubility in water can vary, and it may exhibit basic properties due to the presence of amine groups. Hexedine's reactivity is influenced by its functional groups, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, hexedine is a versatile compound with significance in organic synthesis and research applications.
Formula:C22H45N3
InChI:InChI=1/C22H45N3/c1-6-10-12-20(8-3)14-23-16-22(5)17-24(19-25(22)18-23)15-21(9-4)13-11-7-2/h20-21H,6-19H2,1-5H3
SMILES:CCCCC(CC)CN1CC2(C)CN(CC(CC)CCCC)CN2C1
Synonyms:- 2,6-Bis(2-ethylhexyl)hexahydro-7a-methyl-1H-imidazo[1,5-c]imidazole
- Sterisol
- 2,6-bis(2-ethylhexyl)-7a-methylhexahydro-1H-imidazo[1,5-c]imidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Bis(2-ethylhexyl)-7a-methylhexahydro-1H-imidazo[1,5-c]imidazole (Hexedine)
CAS:Controlled ProductFormula:C22H45N3Color and Shape:NeatMolecular weight:351.612,6-Bis(2-ethylhexyl)-7a-methylhexahydro-1H-imidazo[1,5-c]imidazole (hexedine)
CAS:2,6-Bis(2-ethylhexyl)-7a-methylhexahydro-1H-imidazo[1,5-c]imidazole, known as hexedine, is a synthetic compound, which is primarily utilized in industrial applications. It is derived from a chemical synthesis process involving imidazo-imidazole structures, allowing for specific modifications to yield its characteristic properties. Hexedine operates through a mechanism that enhances surface adhesion and stability when applied to various substrates. The compound’s molecular architecture enables it to form a durable, resistant layer, thereby improving the surface’s integrity and lifespan.
Formula:C22H45N3Purity:Min. 95%Molecular weight:351.6 g/mol




