CymitQuimica logo

CAS 5982-56-9

:

1,2-Ethanedisulfonic Acid Dihydrate

Description:
1,2-Ethanedisulfonic acid dihydrate, with the CAS number 5982-56-9, is an organic sulfonic acid characterized by its two sulfonic acid groups (-SO3H) attached to a two-carbon ethylene backbone. This compound appears as a white crystalline solid and is highly soluble in water, making it useful in various aqueous applications. It is known for its strong acidity and is often utilized as a buffering agent, particularly in biochemical and analytical chemistry contexts. The dihydrate form indicates the presence of two water molecules associated with each molecule of the acid, which can influence its physical properties and reactivity. 1,2-Ethanedisulfonic acid dihydrate is also recognized for its role in synthesizing other chemical compounds and as a reagent in various chemical reactions. Its stability and non-volatile nature make it suitable for laboratory use, while its sulfonic acid groups contribute to its ability to interact with a wide range of substances, enhancing its utility in diverse chemical processes.
Formula:C2H10O8S2
InChI:InChI=1S/C2H6O6S2.2H2O/c3-9(4,5)1-2-10(6,7)8;;/h1-2H2,(H,3,4,5)(H,6,7,8);2*1H2
InChI key:DSGUSEBCDAKBCM-UHFFFAOYSA-N
SMILES:C(CS(=O)(=O)O)S(=O)(=O)O.O.O
Synonyms:
  • 2-Ethanedisulfonic Acid
  • Ethane-1,2-disulfonic acid dihydrate
  • Ethylenedisulfonic acid (dihydrate)
Found 5 products.