CAS 59837-15-9
:N-[(2S,3S,4R,5R,6S)-5-hydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)-4-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]acetamide
Description:
The chemical substance N-[(2S,3S,4R,5R,6S)-5-hydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)-4-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]acetamide, with CAS number 59837-15-9, is a complex organic compound characterized by its intricate structure featuring multiple hydroxyl groups and a nitrophenoxy moiety. This compound belongs to a class of glycosides and is notable for its potential biological activity, which may include antimicrobial or antitumor properties. The presence of multiple stereocenters contributes to its chiral nature, influencing its interaction with biological systems. Its solubility and stability can vary based on environmental conditions, such as pH and temperature. The compound's functional groups, particularly the hydroxyl and acetamide groups, suggest it may participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. Overall, this substance represents a significant area of interest in medicinal chemistry and pharmacology due to its structural complexity and potential therapeutic applications.
Formula:C20H28N2O13
InChI:InChI=1/C20H28N2O13/c1-8(25)21-13-18(35-20-17(29)16(28)14(26)11(6-23)34-20)15(27)12(7-24)33-19(13)32-10-4-2-9(3-5-10)22(30)31/h2-5,11-20,23-24,26-29H,6-7H2,1H3,(H,21,25)/t11-,12-,13-,14-,15-,16-,17-,18+,19+,20-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Galβ(1-3)GalNAc-β-pNP
CAS:Formula:C20H28N2O13Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:504.45Gal β(1-3)galnac-β-pnp
CAS:Formula:C20H28N2O13Purity:98%Color and Shape:SolidMolecular weight:504.4419Galβ(1-3)GalNAc-β-pNP
CAS:Galβ(1-3)GalNAc-β-pNP is a high quality, reagent that is useful as an intermediate in the synthesis of complex compounds. It is also a fine chemical that can be used as a starting material for the synthesis of speciality chemicals. This compound has been used as a building block to produce versatile building blocks and reaction components.Formula:C20H28N2O13Purity:Min. 95%Color and Shape:PowderMolecular weight:504.45 g/mol



