CymitQuimica logo

CAS 59899-89-7

:

methyl 1,2-benzisoxazol-3-ylacetate

Description:
Methyl 1,2-benzisoxazol-3-ylacetate is an organic compound characterized by its unique structure, which includes a benzisoxazole ring fused with an acetate group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. The presence of the benzisoxazole moiety contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Methyl 1,2-benzisoxazol-3-ylacetate may exhibit various pharmacological properties, including anti-inflammatory and analgesic effects, although specific biological activities can vary based on structural modifications and the presence of substituents. Its synthesis often involves the reaction of appropriate precursors under controlled conditions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c1-13-10(12)6-8-7-4-2-3-5-9(7)14-11-8/h2-5H,6H2,1H3
InChI key:VKNXYAQLRDOEFK-UHFFFAOYSA-N
SMILES:COC(=O)Cc1c2ccccc2on1
Found 2 products.