CAS 59914-91-9
:5,7-dihydroxy-2-(4-hydroxyphenyl)-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]-8-[(2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl]-4H-chromen-4-one (non-preferred name)
Description:
The chemical substance known as 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]-8-[(2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl]-4H-chromen-4-one, with the CAS number 59914-91-9, is a complex flavonoid compound. It features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the chromenone structure indicates that it may exhibit biological activity, including anti-inflammatory and anti-cancer effects. The stereochemistry of the molecule, indicated by the specific configurations at various chiral centers, suggests that it may interact with biological systems in a stereospecific manner. This compound is likely soluble in polar solvents due to its numerous hydroxyl groups, which enhance its hydrophilicity. Its intricate structure may also suggest potential applications in pharmaceuticals or nutraceuticals, particularly in the context of natural products derived from plant sources. Further studies would be necessary to fully elucidate its biological activities and potential therapeutic uses.
Formula:C26H28O14
InChI:InChI=1/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13-,17+,18-,21+,22-,23-,25+,26+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Vicenin 3
CAS:Vicenin 3 is an inhibitor of angiotensin-converting enzyme (ACE; IC50: 46.91 μM) from the aerial parts of Desmodium styracifolium.Formula:C26H28O14Purity:99.8% - 99.99%Color and Shape:SolidMolecular weight:564.49Ref: TM-T13299
1mg71.00€5mg152.00€1mL*10mM (DMSO)197.00€10mg245.00€25mg413.00€50mg597.00€100mg835.00€Vicenin iii
CAS:Natural glycosideFormula:C26H28O14Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:564.5Vicenin III
CAS:Vicenin III is a natural flavonoid compound, which is a type of polyphenolic metabolite commonly found in various plant species. It is primarily extracted from herbaceous plants and certain fruits and vegetables, where it acts as a secondary metabolite contributing to the plant's defense mechanisms. The compound exerts its effects through antioxidant properties, which involve scavenging free radicals and reducing oxidative stress at the cellular level. Additionally, it demonstrates anti-inflammatory activity by modulating key signaling pathways and inhibiting pro-inflammatory mediators.
Formula:C26H28O14Purity:Min. 95%Color and Shape:PowderMolecular weight:564.49 g/mol





