CAS 59920-31-9
:2,5-Dideoxy-2,5-imino-D-mannitol
Description:
2,5-Dideoxy-2,5-imino-D-mannitol, with the CAS number 59920-31-9, is a synthetic compound that belongs to the class of imino sugars. It is characterized by the presence of both hydroxyl and imino functional groups, which contribute to its unique chemical properties. This compound is a derivative of D-mannitol, a sugar alcohol, and exhibits structural features that make it a potential inhibitor of glycosidases, enzymes that play a crucial role in carbohydrate metabolism. The imino group introduces a nitrogen atom into the structure, which can influence its biological activity and solubility. 2,5-Dideoxy-2,5-imino-D-mannitol has garnered interest in medicinal chemistry for its potential applications in treating conditions related to glycosylation disorders and diabetes. Its stability, reactivity, and ability to mimic natural substrates make it a valuable compound for research in biochemistry and pharmacology. However, detailed studies on its pharmacokinetics and toxicity are essential for understanding its therapeutic potential.
Formula:C6H13NO4
InChI:InChI=1S/C6H13NO4/c8-1-3-5(10)6(11)4(2-9)7-3/h3-11H,1-2H2/t3-,4-,5-,6-/m1/s1
InChI key:InChIKey=PFYHYHZGDNWFIF-KVTDHHQDSA-N
SMILES:C(O)[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)N1
Synonyms:- (2R,3R,4R,5R)-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol
- (2R,3R,4R,5R)-3,4-Dihydroxy-2,5-pyrrolidinedimethanol
- 2(R),5(R)-Bis(hydroxymethyl)-3(R),4(R)-dihydroxypyrrolidine
- 2,5-Bis(Hydroxymethyl)Pyrrolidine-3,4-Diol
- 2,5-Dideoxy-2,5-imino-<span class="text-smallcaps">D</span>-mannitol
- 2,5-Dideoxy-2,5-imino-D-mannitol
- 2,5-Pyrrolidinedimethanol, 3,4-dihydroxy-, (2R,3R,4R,5R)-
- 2,5-Pyrrolidinedimethanol, 3,4-dihydroxy-, [2R-(2α,3β,4α,5β)]-
- Dmdp
- α-Glucosidase
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2R,3R,4R,5R)-2,5-Bis(hydroxymethyl)pyrrolidine-3,4-diol
CAS:(2R,3R,4R,5R)-2,5-Bis(hydroxymethyl)pyrrolidine-3,4-diolFormula:C6H13NO4Purity:98%Molecular weight:163.17(2R,3R,4R,5R)-2,5-Bis(hydroxymethyl)pyrrolidine-3,4-diol
CAS:Formula:C6H13NO4Purity:98%Color and Shape:SolidMolecular weight:163.17172,5-Dideoxy-2,5-imino-D-mannitol
CAS:Controlled ProductStability Hygroscopic
Applications A glucosidase inhibitor.
References Fellows, L.E.: Pestic. Sci., 17, 602 (1986)Formula:C6H13NO4Color and Shape:NeatMolecular weight:163.172,5-Dideoxy-2,5-imino-D-mannitol
CAS:2,5-Dideoxy-2,5-imino-D-mannitol is an iminosugar compound, which is a synthetic derivative with potent glycosidase inhibitory properties. The compound, typically synthesized through complex organic processes, acts by mimicking the transition state of natural substrates in glycosidases, thereby inhibiting their enzymatic activity. This mode of action involves binding to the active site of glycosidase enzymes, preventing the normal hydrolysis of glycosidic bonds.
Formula:C6H13NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:163.17 g/mol





