CymitQuimica logo

CAS 600-29-3

:

1,2-dimethyl-1H-pyrrole

Description:
1,2-Dimethyl-1H-pyrrole is a heterocyclic organic compound characterized by a five-membered ring containing nitrogen. It features two methyl groups attached to the first and second carbon atoms of the pyrrole ring. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its non-polar characteristics. The presence of the nitrogen atom in the ring contributes to its basicity and reactivity, making it a useful intermediate in organic synthesis and the production of various pharmaceuticals and agrochemicals. Additionally, 1,2-dimethyl-1H-pyrrole can participate in various chemical reactions, including electrophilic substitutions and cycloadditions, due to the electron-rich nature of the pyrrole ring. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, its unique structure and properties make it an interesting compound in the field of organic chemistry.
Formula:C6H9N
InChI:InChI=1/C6H9N/c1-6-4-3-5-7(6)2/h3-5H,1-2H3
InChI key:GNFLFHZJXXFDRA-UHFFFAOYSA-N
SMILES:CC1=CC=CN1C
Synonyms:
  • 1H-pyrrole, 1,2-dimethyl-
  • 1,2-dimethyl-1H-Pyrrole
Found 5 products.