CymitQuimica logo

CAS 6002-40-0

:

Di-t-butylmethylphosphine

Description:
Di-t-butylmethylphosphine is an organophosphorus compound characterized by its phosphine functional group, where a phosphorus atom is bonded to two t-butyl groups and one methyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its strong nucleophilic properties due to the presence of the phosphorus atom. It has a relatively low boiling point compared to other phosphines, which can make it volatile. Di-t-butylmethylphosphine is often used as a ligand in coordination chemistry and catalysis, particularly in reactions involving transition metals. Its sterically hindered structure, due to the bulky t-butyl groups, can influence the reactivity and selectivity of metal complexes. Additionally, it is important to handle this compound with care, as phosphines can be toxic and may pose health risks if inhaled or ingested. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C9H21P
InChI:InChI=1S/C9H21P/c1-8(2,3)10(7)9(4,5)6/h1-7H3
InChI key:JURBTQKVGNFPRJ-UHFFFAOYSA-N
SMILES:CC(C)(C)P(C)C(C)(C)C
Found 1 products.