CAS 60137-06-6
:Cucurbitacin S
Description:
Cucurbitacin S is a triterpenoid compound belonging to the cucurbitacin family, which is primarily derived from various plants in the Cucurbitaceae family, such as cucumbers and gourds. This compound is known for its bitter taste and has been studied for its potential pharmacological properties, including anti-inflammatory, anticancer, and antiparasitic effects. Cucurbitacin S exhibits a complex structure characterized by a tetracyclic triterpene framework, which contributes to its biological activity. It is often isolated from plant sources and can be used in various research applications to explore its effects on cellular processes. Additionally, due to its bitter nature, it may serve as a natural deterrent against herbivores. However, the use of Cucurbitacin S in therapeutic contexts requires careful consideration of its toxicity and dosage, as high concentrations can be harmful. Overall, Cucurbitacin S represents a significant area of interest in natural product chemistry and pharmacology, warranting further investigation into its mechanisms of action and potential applications.
Formula:C30H42O6
InChI:InChI=1S/C30H42O6/c1-15-18(31)12-23(27(4,5)35)36-20-13-28(6)21-10-9-16-17(11-19(32)25(34)26(16,2)3)30(21,8)22(33)14-29(28,7)24(15)20/h9,11,15,17,20-21,23-24,32,35H,10,12-14H2,1-8H3/t15-,17-,20-,21+,23+,24+,28+,29-,30+/m1/s1
InChI key:InChIKey=MBYLRWSUZLFUTO-PQNVQGKDSA-N
SMILES:C[C@]12[C@]3([C@](C)([C@]4(C(=CC3)C(C)(C)C(=O)C(O)=C4)[H])C(=O)C[C@]1(C)[C@@]5([C@@](C2)(O[C@H]([C@](C)(C)O)CC(=O)[C@H]5C)[H])[H])[H]
Synonyms:- (9β,10α,16α,24S)-16,24-Epoxy-2,25-dihydroxy-9-methyl-19-norlanosta-1,5-diene-3,11,22-trione
- 19-Norlanosta-1,5-diene-3,11,22-trione, 16,24-epoxy-2,25-dihydroxy-9-methyl-, (9beta,10alpha,16alpha,24S)-
- 19-Norlanosta-1,5-diene-3,11,22-trione, 16,24-epoxy-2,25-dihydroxy-9-methyl-, (9β,10α,16α,24S)-
- Cucurbitacin S
- Cucurbitacins
- dihydrocucurbitacin F,25-0-acetate
- hemsecin A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cucurbitacin S
CAS:Formula:C30H42O6Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:498.66Curcurbitacin IIa
CAS:Controlled Product<p>Curcurbitacin IIa is a cucurbitacin that has been shown to inhibit the growth of mouse tumor cells. It is also an anti-cancer compound and has been shown to suppress the proliferation of human T-cell lymphoma cells. Curcurbitacin IIa inhibits the activity of a variety of enzymes, including thymidine kinase, ribonucleotide reductase, DNA polymerase, and RNA polymerase. This compound also suppresses the production of prostaglandins by inhibiting cyclooxygenase. Curcurbitacin IIa has been found to bind specifically to calf thymus DNA in order to inhibit bacterial growth.</p>Formula:C30H42O6Purity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:498.65 g/mol


