CymitQuimica logo

CAS 60221-37-6

:

Ethanol, 2-[2-[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethoxy]ethoxy]-

Description:
The chemical substance known as "Ethanol, 2-[2-[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethoxy]ethoxy]-" with CAS number 60221-37-6 is a complex ether derivative. It features a tetrahydro-2H-pyran moiety, which contributes to its cyclic structure and potential for forming hydrogen bonds. This compound is characterized by its multiple ethoxy groups, which enhance its solubility in polar solvents and may influence its reactivity and interaction with biological systems. Ethanol derivatives like this one are often used in various applications, including as solvents, in pharmaceuticals, and in chemical synthesis. The presence of the tetrahydro-pyran ring suggests potential applications in drug delivery or as a building block in organic synthesis due to its ability to stabilize reactive intermediates. Additionally, the compound's structure may impart specific physical properties, such as boiling point and viscosity, which are important for its practical applications. Overall, this substance exemplifies the diverse functionalities that can arise from complex organic molecules.
Formula:C11H22O5
InChI:InChI=1S/C11H22O5/c12-4-6-13-7-8-14-9-10-16-11-3-1-2-5-15-11/h11-12H,1-10H2
InChI key:KUBUREHZQPDYHT-UHFFFAOYSA-N
SMILES:C1CCOC(C1)OCCOCCOCCO
Found 5 products.