CAS 6027-89-0: L-Gulose
Description:L-Gulose is a sugar alcohol and an aldohexose, classified as a monosaccharide. It is a stereoisomer of D-gulose, differing in the configuration around specific carbon atoms. L-Gulose is typically found in trace amounts in nature and is not as widely studied as its D counterpart. It is a white crystalline solid that is soluble in water, making it suitable for various biochemical applications. The molecule features six carbon atoms, with hydroxyl groups (-OH) attached to several of them, contributing to its hydrophilicity. L-Gulose can participate in various chemical reactions typical of sugars, including oxidation and reduction, and can serve as a substrate for specific enzymes. Its potential applications include use in food science, pharmaceuticals, and as a research tool in carbohydrate chemistry. However, due to its limited availability and less common occurrence, research on L-gulose is not as extensive as that of more prevalent sugars.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5-,6-/m1/s1
InChI key:InChIKey=GZCGUPFRVQAUEE-JGWLITMVSA-N
SMILES:O=CC(O)C(O)C(O)C(O)CO
- Synonyms:
- <span class="text-smallcaps">L</span>-Gulose
- Gulose, <span class="text-smallcaps">L</span>-
- L-gulopyranose
- alpha-L-gulopyranose
- beta-L-gulopyranose
- Gulose, L-
- L-Gulose
