CymitQuimica logo

CAS 60331-15-9

:

Pyrimidine, 4-chloro-6-methoxy-2-methyl-5-nitro-

Description:
Pyrimidine, 4-chloro-6-methoxy-2-methyl-5-nitro- is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This specific compound features several substituents that influence its chemical properties and reactivity. The presence of a chloro group at the 4-position, a methoxy group at the 6-position, a methyl group at the 2-position, and a nitro group at the 5-position contributes to its unique chemical behavior. The nitro group is known for its electron-withdrawing properties, which can enhance the compound's reactivity in electrophilic substitution reactions. Additionally, the methoxy group can provide some degree of electron donation through resonance, affecting the overall electronic distribution within the molecule. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its CAS number, 60331-15-9, allows for easy identification and reference in chemical databases.
Formula:C6H6ClN3O3
InChI:InChI=1S/C6H6ClN3O3/c1-3-8-5(7)4(10(11)12)6(9-3)13-2/h1-2H3
InChI key:XENBELIGWDKZOP-UHFFFAOYSA-N
SMILES:CC1=NC(=C(C(=N1)Cl)[N+](=O)[O-])OC
Found 4 products.