CymitQuimica logo

CAS 6038-59-1

:

3'-O-methyluridine

Description:
3'-O-methyluridine is a modified nucleoside, specifically a derivative of uridine, where a methoxy group is attached to the 3' hydroxyl position of the ribose sugar. This modification can influence the nucleoside's biological activity, stability, and interaction with nucleic acids. 3'-O-methyluridine is known to play a role in various biochemical processes, including RNA synthesis and modification, and is often studied for its potential applications in molecular biology and therapeutic development. The presence of the methoxy group can enhance the resistance of the nucleoside to enzymatic degradation, making it a valuable tool in research and potential drug design. Additionally, this compound may exhibit unique properties in terms of binding affinity and specificity when incorporated into RNA molecules, which can affect the overall function of the RNA. Its CAS number, 6038-59-1, is a unique identifier that facilitates the cataloging and referencing of this specific chemical substance in scientific literature and databases.
Formula:C10H14N2O6
InChI:InChI=1/C10H14N2O6/c1-17-8-5(4-13)18-9(7(8)15)12-3-2-6(14)11-10(12)16/h2-3,5,7-9,13,15H,4H2,1H3,(H,11,14,16)
InChI key:YKNATSNMFLEFRB-ZOQUXTDFSA-N
SMILES:COC1C(CO)OC(C1O)n1ccc(nc1=O)O
Synonyms:
  • 1-(3-O-methylpentofuranosyl)pyrimidine-2,4(1H,3H)-dione
Found 7 products.