CAS 6038-59-1
:3'-O-methyluridine
Description:
3'-O-methyluridine is a modified nucleoside, specifically a derivative of uridine, where a methoxy group is attached to the 3' hydroxyl position of the ribose sugar. This modification can influence the nucleoside's biological activity, stability, and interaction with nucleic acids. 3'-O-methyluridine is known to play a role in various biochemical processes, including RNA synthesis and modification, and is often studied for its potential applications in molecular biology and therapeutic development. The presence of the methoxy group can enhance the resistance of the nucleoside to enzymatic degradation, making it a valuable tool in research and potential drug design. Additionally, this compound may exhibit unique properties in terms of binding affinity and specificity when incorporated into RNA molecules, which can affect the overall function of the RNA. Its CAS number, 6038-59-1, is a unique identifier that facilitates the cataloging and referencing of this specific chemical substance in scientific literature and databases.
Formula:C10H14N2O6
InChI:InChI=1/C10H14N2O6/c1-17-8-5(4-13)18-9(7(8)15)12-3-2-6(14)11-10(12)16/h2-3,5,7-9,13,15H,4H2,1H3,(H,11,14,16)
InChI key:YKNATSNMFLEFRB-ZOQUXTDFSA-N
SMILES:COC1C(CO)OC(C1O)n1ccc(nc1=O)O
Synonyms:- 1-(3-O-methylpentofuranosyl)pyrimidine-2,4(1H,3H)-dione
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-((2R,3R,4S,5R)-3-Hydroxy-5-(hydroxymethyl)-4-methoxytetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione
CAS:1-((2R,3R,4S,5R)-3-Hydroxy-5-(hydroxymethyl)-4-methoxytetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dioneFormula:C10H14N2O6Purity:95%Molecular weight:258.233'-O-Methyluridine
CAS:Nucleoside - 3’-O-methylnucleosideFormula:C10H14N2O6Color and Shape:SolidMolecular weight:258.2283’-O-Methyluridine
CAS:1-((2R,3R,4S,5R)-3-Hydroxy-5-(hydroxymethyl)-4-methoxytetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dioneFormula:C10H14N2O6Purity:95%Molecular weight:258.233'-O-Methyluridine
CAS:3'-O-Methyluridine is a nucleoside that is used in the preparation of oligonucleotides and as a substrate for uridine phosphorylase. It is used to study the termination of RNA synthesis, which occurs when there are no more ribose residues in the RNA template strand. When this happens, an adenosine residue is added by polyphosphate kinase to the 3' end of the RNA strand. This addition causes a release of pyrophosphate and leads to end of DNA synthesis. The acid hydrolysis technique can be used to separate 3'-O-methyluridine from other nucleotides. This reaction produces guanosine, which can be detected using polymerase chain reaction (PCR) techniques such as polyacrylamide gel electrophoresis (PAGE).
Formula:C10H14N2O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:258.23 g/mol






