CAS 60421-23-0
:Methyl 1-amino-1-cyclopentanecarboxylate hydrochloride
Description:
Methyl 1-amino-1-cyclopentanecarboxylate hydrochloride, with the CAS number 60421-23-0, is a chemical compound characterized by its structure, which includes a cyclopentane ring substituted with an amino group and a carboxylate moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the amino and carboxylate functional groups. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which can enhance its stability and solubility. Methyl 1-amino-1-cyclopentanecarboxylate hydrochloride may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Its synthesis involves standard organic reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. As with all chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c1-10-6(9)7(8)4-2-3-5-7/h2-5,8H2,1H3
SMILES:COC(=O)C1(CCCC1)N
Synonyms:- Cycloleucine Methyl Ester Hcl
- Methyl-1-aminocyclopentanecarboxylate hydrochloride
- Methyl1-Aminocyclopentanecarboxylatehcl(Cycloleucinemethylesterhcl)
- 1-Aminocyclopentane-1-carboxylic acid methyl ester hydrochloride Cycloleucine Methyl Ester.HCl
- Methyl 1-Aminocyclopentylcarboxylate Hcl
- methyl 1-aminocyclopentanecarboxylate, HCl
- Methyl 1-Aminocyclopentanecarboxylate
- Methyl 1-Aminocyclopentane-1-Carboxylate Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 1-Aminocyclopentanecarboxylate Hydrochloride
CAS:Formula:C7H13NO2·HClPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:179.64Methyl 1-Aminocyclopentanecarboxylate HCl
CAS:Methyl 1-aminocyclopentanecarboxylate hydrochlorideFormula:C7H14ClNO2Purity:95%Molecular weight:179.64Methyl 1-amino-1-cyclopentanecarboxylate, HCl
CAS:Formula:C7H14ClNO2Purity:95%Color and Shape:SolidMolecular weight:179.6446Methyl 1-Aminocyclopentanecarboxylate Hydrochloride
CAS:Methyl 1-Aminocyclopentanecarboxylate HydrochlorideFormula:C7H13NO2·ClHPurity:98%Color and Shape:SolidMolecular weight:179.64455Cycloleucine methyl ester hydrochloride
CAS:Formula:C7H14ClNO2Purity:97%Color and Shape:SolidMolecular weight:179.64




