CAS 6051-25-8
:2-oxaspiro[4.5]decane-1,3-dione
Description:
2-Oxaspiro[4.5]decane-1,3-dione, with the CAS number 6051-25-8, is a bicyclic organic compound characterized by its unique spiro structure, which consists of a fused ring system. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which significantly influence its reactivity and chemical behavior. The oxaspiro framework contributes to its potential applications in organic synthesis and materials science. Typically, compounds of this nature exhibit moderate polarity due to the presence of carbonyl groups, which can participate in hydrogen bonding and other intermolecular interactions. The spiro configuration often imparts rigidity to the molecular structure, affecting its conformational properties and stability. Additionally, 2-oxaspiro[4.5]decane-1,3-dione may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its synthesis and derivatives could be explored for various applications, including pharmaceuticals and agrochemicals, due to the versatility of the spirocyclic framework in organic chemistry.
Formula:C9H12O3
InChI:InChI=1/C9H12O3/c10-7-6-9(8(11)12-7)4-2-1-3-5-9/h1-6H2
SMILES:C1CCC2(CC1)CC(=O)OC2=O
Synonyms:- 2-Oxaspiro[4.5]decane-1,3-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Oxaspiro[4.5]decane-1,3-dione
CAS:2-Oxaspiro[4.5]decane-1,3-dioneFormula:C9H12O3Purity:≥95%Color and Shape:SolidMolecular weight:168.189782-Oxaspiro[4.5]Decane-1,3-Dione
CAS:Formula:C9H12O3Purity:95%Color and Shape:SolidMolecular weight:168.18982-Oxaspiro[4.5]decane-1,3-dione
CAS:2-Oxaspiro[4.5]decane-1,3-dione is a heterocyclic compound that is used in pharmaceutical research and the development of new drugs. It can be synthesized by reacting phenylhydrazine with 2-oxaspiro[4.5]decane-1,3-dione. The nitrogen atom in this molecule is essential for its activity and pharmacological properties, which are similar to those of phenacetin. The profile of 2-oxaspiro[4.5]decane-1,3-dione has been studied using physicochemical parameters such as molecular weight and melting point. This molecule was first discovered to have antilead activities by Friedel and Crafts reaction with lead iodide.Formula:C9H12O3Purity:Min. 95%Molecular weight:168.19 g/mol




