CymitQuimica logo

CAS 6051-66-7

:

2,5-Dimethylterephthalic Acid

Description:
2,5-Dimethylterephthalic acid, with the CAS number 6051-66-7, is an aromatic dicarboxylic acid characterized by the presence of two methyl groups located at the 2 and 5 positions of the terephthalic acid structure. This compound is typically a white crystalline solid that is soluble in organic solvents but has limited solubility in water. It is primarily used as an intermediate in the synthesis of polyesters and other polymers, contributing to the production of high-performance materials. The presence of the methyl groups enhances its thermal stability and modifies its physical properties, making it suitable for various industrial applications. Additionally, 2,5-dimethylterephthalic acid can participate in various chemical reactions, including esterification and polymerization, which are essential for creating diverse polymeric materials. Its chemical structure allows for potential applications in the development of specialty chemicals and additives, further expanding its utility in the chemical industry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H10O4
InChI:InChI=1/C10H10O4/c1-5-3-8(10(13)14)6(2)4-7(5)9(11)12/h3-4H,1-2H3,(H,11,12)(H,13,14)
InChI key:FKUJGZJNDUGCFU-UHFFFAOYSA-N
SMILES:Cc1cc(c(C)cc1C(=O)O)C(=O)O
Synonyms:
  • 1,4-Benzenedicarboxylic Acid, 2,5-Dimethyl-
  • 2,5-Dimethylbenzene-1,4-Dicarboxylic Acid
  • 2,5-dimethyl-1,4-Benzenedicarboxylic acid
Found 7 products.