CymitQuimica logo

CAS 6053-46-9

:

1-carboxymethyl-2,3,5,cyclopentanetricarboxylicacid-2,6:3,5-dianhydride

Description:
1-Carboxymethyl-2,3,5-cyclopentanetricarboxylic acid-2,6:3,5-dianhydride, with CAS number 6053-46-9, is a complex organic compound characterized by its multiple carboxylic acid functional groups and an anhydride structure. This substance is typically a white to off-white solid, exhibiting high solubility in polar solvents due to the presence of carboxylic acid groups. It is known for its potential applications in organic synthesis, particularly in the preparation of polymers and as a reagent in various chemical reactions. The presence of multiple carboxylic acid groups suggests that it can participate in acid-base reactions and form salts or esters. Additionally, the cyclic structure may impart unique steric and electronic properties, influencing its reactivity and interactions with other molecules. As with many organic compounds, handling should be done with care, considering potential reactivity and safety data. Overall, this compound is of interest in both academic research and industrial applications due to its versatile chemical properties.
Formula:C10H8O6
InChI:InChI=1S/C10H8O6/c11-6-2-3-4-1-5(7(3)10(14)15-6)9(13)16-8(4)12/h3-5,7H,1-2H2
InChI key:QVEIRZNRYOJFCL-UHFFFAOYSA-N
SMILES:C1C2C3CC(=O)OC(=O)C3C1C(=O)OC2=O
Synonyms:
  • Tcaah
  • 2,3,5-Tricarboxycyclopentaneacetic dianhydride
Found 4 products.