CAS 60562-15-4
:1,2-dilauroyl-sn-glycerol
Description:
1,2-Dilauroyl-sn-glycerol, with the CAS number 60562-15-4, is a glycerol derivative characterized by the presence of two lauroyl (dodecanoyl) fatty acid chains esterified to the first and second hydroxyl groups of glycerol. This compound is a type of diglyceride, which is commonly used in various applications, including food, cosmetics, and pharmaceuticals, due to its emulsifying and stabilizing properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of long-chain fatty acids contributes to its hydrophobic characteristics, while the glycerol backbone provides some hydrophilicity, making it useful in forming emulsions. Additionally, 1,2-dilauroyl-sn-glycerol can serve as a surfactant, enhancing the solubility of other compounds in formulations. Its stability and compatibility with a range of ingredients make it a valuable component in various formulations, particularly in the food industry for improving texture and mouthfeel.
Formula:C27H52O5
InChI:InChI=1/C27H52O5/c1-3-5-7-9-11-13-15-17-19-21-26(29)31-24-25(23-28)32-27(30)22-20-18-16-14-12-10-8-6-4-2/h25,28H,3-24H2,1-2H3/t25-/m0/s1
SMILES:CCCCCCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCCCC
Synonyms:- Dodecanoic acid, (1S)-1-(hydroxymethyl)-1,2-ethanediyl ester
- (2S)-3-hydroxypropane-1,2-diyl didodecanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-Dilauroyl-sn-glycerol
CAS:1,2-Dilauroyl-sn-glycerol ((S)-1,2-Dilaurin) is primarily composed of the interaction of 1,2-dilauroyl-sn-glycerol (1,2-DLG) with phosphatidylcholine (PC)Formula:C27H52O5Purity:99.93% - 99.95%Color and Shape:SolidMolecular weight:456.71,2-Dilauroyl-sn-glycerol
CAS:<p>1,2-Dilauroyl-sn-glycerol is a fatty acid that is found in low concentrations in the blood. It is an acyl chain of a glyceride and is synthesized by the enzyme lipolytic enzymes. It has been shown to have anti-inflammatory properties, as it inhibits leukocyte antigen expression and inflammatory enzymes such as monolayer. 1,2-Dilauroyl-sn-glycerol has also been shown to have a role in the uptake of cholesterol from the brain, which may be due to its effect on body mass index.</p>Formula:C27H52O5Purity:Min. 95%Molecular weight:456.7 g/mol1,2-Dilauroyl-sn-glycerol
CAS:<p>Bachem ID: 4005366.</p>Formula:C27H52O5Purity:> 98%Color and Shape:WhiteMolecular weight:456.71




