CAS 606-91-7
:(6aR,11aR)-3,9-dimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene
Description:
The chemical substance known as (6aR,11aR)-3,9-dimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene, with the CAS number 606-91-7, is a complex organic compound characterized by its unique bicyclic structure that incorporates both benzofuran and chromene moieties. This compound typically exhibits a range of physical and chemical properties, including solubility in organic solvents and potential bioactivity, which may include antioxidant or anti-inflammatory effects. The presence of methoxy groups contributes to its chemical reactivity and may influence its interaction with biological systems. Additionally, the stereochemistry indicated by the (6aR,11aR) configuration suggests specific spatial arrangements that can affect the compound's pharmacological properties. Such compounds are often of interest in medicinal chemistry and natural product research due to their potential therapeutic applications. Overall, the characteristics of this substance make it a subject of interest for further studies in both synthetic and medicinal chemistry.
Formula:C17H16O4
InChI:InChI=1/C17H16O4/c1-18-10-4-6-13-15(7-10)20-9-14-12-5-3-11(19-2)8-16(12)21-17(13)14/h3-8,14,17H,9H2,1-2H3/t14-,17-/m0/s1
SMILES:COc1ccc2c(c1)OC[C@H]1c3ccc(cc3O[C@@H]21)OC
Synonyms:- 6H-Benzofuro(3,2-c)(1)benzopyran, 6a,11a-dihydro-3,9-dimethoxy-, (6aR,11aR)-rel-
- 6H-benzofuro[3,2-c][1]benzopyran, 6a,11a-dihydro-3,9-dimethoxy-, (6aR,11aR)-
- 6H-Benzofuro[3,2-c][1]benzopyran, 6a,11a-dihydro-3,9-dimethoxy-, (6aR-cis)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6H-Benzofuro[3,2-c][1]benzopyran, 6a,11a-dihydro-3,9-dimethoxy-,(6aR,11aR)-
CAS:Formula:C17H16O4Purity:98.0%Molecular weight:284.3065Homopterocarpin
CAS:Homopterocarpin & Pterocarpus offer ulcer protection by antioxidant action, gastric balance, liver protection, anticancer & antifeedant qualities.Formula:C17H16O4Purity:98%Color and Shape:SolidMolecular weight:284.311Homopterocarpin
CAS:Homopterocarpin is a naturally occurring flavonoid, which is an isoflavonoid compound found primarily in the heartwood of Pterocarpus species. These trees, belonging to the Leguminosae family, are indigenous to tropical regions and have been utilized in traditional medicine for their bioactive properties. Homopterocarpin operates through various biochemical pathways, notably by exhibiting antioxidant and anti-inflammatory effects. Its mode of action involves the modulation of inflammatory cytokines and the scavenging of reactive oxygen species, contributing to its potential efficacy in managing oxidative stress-related disorders.Formula:C17H16O4Purity:Min. 95%Color and Shape:PowderMolecular weight:284.31 g/mol



