CymitQuimica logo

CAS 606488-94-2

:

Cyclohexanecarboxylic acid, 3-hydroxy-

Description:
Cyclohexanecarboxylic acid, 3-hydroxy- is an organic compound characterized by a cyclohexane ring with a carboxylic acid group and a hydroxyl group attached to the third carbon of the ring. This compound typically exhibits properties common to carboxylic acids, such as being a weak acid due to the presence of the carboxyl group, which can donate a proton in solution. The hydroxyl group contributes to its polarity, enhancing its solubility in polar solvents like water. The presence of both functional groups allows for potential hydrogen bonding, influencing its boiling and melting points. Additionally, cyclohexanecarboxylic acid, 3-hydroxy- may participate in various chemical reactions, including esterification and oxidation, making it useful in organic synthesis and potentially in pharmaceuticals or agrochemicals. Its structural features also suggest that it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and applications.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c8-6-3-1-2-5(4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10)
InChI key:JBZDHFKPEDWWJC-UHFFFAOYSA-N
SMILES:C1CC(CC(C1)O)C(=O)O
Found 7 products.