CAS 606488-94-2
:Cyclohexanecarboxylic acid, 3-hydroxy-
Description:
Cyclohexanecarboxylic acid, 3-hydroxy- is an organic compound characterized by a cyclohexane ring with a carboxylic acid group and a hydroxyl group attached to the third carbon of the ring. This compound typically exhibits properties common to carboxylic acids, such as being a weak acid due to the presence of the carboxyl group, which can donate a proton in solution. The hydroxyl group contributes to its polarity, enhancing its solubility in polar solvents like water. The presence of both functional groups allows for potential hydrogen bonding, influencing its boiling and melting points. Additionally, cyclohexanecarboxylic acid, 3-hydroxy- may participate in various chemical reactions, including esterification and oxidation, making it useful in organic synthesis and potentially in pharmaceuticals or agrochemicals. Its structural features also suggest that it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and applications.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c8-6-3-1-2-5(4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10)
InChI key:JBZDHFKPEDWWJC-UHFFFAOYSA-N
SMILES:C1CC(CC(C1)O)C(=O)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Hydroxycyclohexanecarboxylic Acid (cis- and trans- mixture)
CAS:Formula:C7H12O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:144.173-Hydroxycyclohexane-1-carboxylic acid
CAS:3-Hydroxycyclohexane-1-carboxylic acidFormula:C7H12O3Purity:95%Molecular weight:144.168383-Hydroxycyclohexanecarboxylic acid
CAS:Formula:C7H12O3Purity:97%Color and Shape:SolidMolecular weight:144.16843-Hydroxycyclohexanecarboxylic acid
CAS:3-Hydroxycyclohexanecarboxylic acidFormula:C7H12O3Purity:95%Molecular weight:144.173-Hydroxycyclohexanecarboxylic acid
CAS:Formula:C7H12O3Purity:95%Color and Shape:LiquidMolecular weight:144.173-Hydroxycyclohexanecarboxylic Acid (cis- and trans- mixture)
CAS:3-Hydroxycyclohexanecarboxylic Acid is a chiral, synthesized organic compound. It is used as a precursor to medicines and has been shown to be effective in inhibiting plasmin activity through the formation of an aluminium complex. 3-Hydroxycyclohexanecarboxylic Acid is also used for the production of chromatographic columns, sensors, and aluminium oxide. It can be purified by crystallization or by using a formylation reaction with benzyl chloride. 3-Hydroxycyclohexanecarboxylic Acid has acidic properties at high pH and forms an aluminium complex with the cavity of an aluminium oxide sensor. The efficiency of this compound is related to its chirality, which can be determined by gas chromatography.Formula:C7H12O3Purity:Min. 95%Molecular weight:144.17 g/mol3-Hydroxycyclohexane-1-carboxylic acid
CAS:Controlled ProductApplications 3-Hydroxycyclohexane-1-carboxylic acid
Formula:C7H12O3Color and Shape:NeatMolecular weight:144.168






