CAS 60658-41-5
:Tetradecanoic-d27 Acid
Description:
Tetradecanoic-d27 acid, also known as myristic-d27 acid, is a deuterated form of tetradecanoic acid, a saturated fatty acid with a 14-carbon chain. The "d27" designation indicates that the molecule contains 27 deuterium atoms, which are isotopes of hydrogen, replacing regular hydrogen atoms in the structure. This modification is often used in research and analytical applications, particularly in mass spectrometry, to trace metabolic pathways or to study lipid metabolism. Tetradecanoic-d27 acid is typically a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents. Its chemical formula reflects the presence of carbon, hydrogen, and deuterium, and it exhibits typical fatty acid characteristics, such as a high melting point and the ability to form esters and amides. The presence of deuterium enhances its stability and can improve the accuracy of analytical techniques. Overall, tetradecanoic-d27 acid serves as a valuable tool in biochemical research and applications involving lipid analysis.
Formula:C14HD27O2
InChI:InChI=1/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2
SMILES:C(C(C(C(C(C(C(C(C(C(C(C(C(C(=O)O)([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Myristic acid-D27
CAS:Myristic acid-D27 is the deuterated form of myristic acid. Myristic acid (T3949) is a saturated 14-carbon fatty acid found in most animal and plant fats, particularly in dairy fat, coconut oil, palm oil, and nutmeg oil.Formula:C14H28O2Molecular weight:255.54Tetradecanoic-d27 Acid
CAS:Formula:CD3(CD2)12COOHPurity:98 atom % DColor and Shape:White SolidMolecular weight:255.3784Myristic Acid-d27
CAS:Controlled ProductApplications Myristic Acid (D27, 98%) (cas# 60658-41-5) is a useful research chemical.
Formula:C14D27HO2Purity:98%Color and Shape:NeatMolecular weight:255.54





