CymitQuimica logo

CAS 60770-49-2

:

5-Fluorobenzofuran-3-one

Description:
5-Fluorobenzofuran-3-one, with the CAS number 60770-49-2, is a synthetic organic compound characterized by its unique structure that combines a benzofuran moiety with a fluorine substituent. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties due to the presence of the benzene ring. The fluorine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry and drug development. 5-Fluorobenzofuran-3-one is soluble in organic solvents, which facilitates its use in various chemical reactions and applications. Its molecular structure allows for potential interactions with biological targets, contributing to its significance in research related to pharmaceuticals. Additionally, the compound's stability and reactivity can vary depending on environmental conditions, such as temperature and pH. Overall, 5-Fluorobenzofuran-3-one is a valuable compound in the field of organic synthesis and medicinal chemistry, with ongoing research exploring its potential applications.
Formula:C8H5FO2
InChI:InChI=1S/C8H5FO2/c9-5-1-2-8-6(3-5)7(10)4-11-8/h1-3H,4H2
InChI key:AOFLDWWKVCKMDV-UHFFFAOYSA-N
SMILES:C1C(=O)C2=C(O1)C=CC(=C2)F
Synonyms:
  • 5-Fluoro-2,3-dihydro-1-benzofuran-3-one
  • 5-Fluoro-Benzofuran-3-One
  • 5-Chloro-3-Benzofuranone
  • 5-fluorobenzofuran-3(2H)-one
Found 5 products.