CymitQuimica logo

CAS 60832-72-6

:

Oxazolo[4,5-b]pyridin-2(3H)-one

Description:
Oxazolo[4,5-b]pyridin-2(3H)-one, with the CAS number 60832-72-6, is a heterocyclic compound characterized by a fused ring system that incorporates both oxazole and pyridine moieties. This compound typically exhibits a planar structure, which can contribute to its potential biological activity and interactions with other molecules. It is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the presence of reactive functional groups. The compound may display interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Additionally, the presence of nitrogen and oxygen atoms in its structure can influence its electronic properties, potentially affecting its reactivity and interactions with biological targets. Overall, Oxazolo[4,5-b]pyridin-2(3H)-one represents a versatile scaffold for further chemical exploration and development.
Formula:C6H4N2O2
InChI:InChI=1S/C6H4N2O2/c9-6-8-5-4(10-6)2-1-3-7-5/h1-3H,(H,7,8,9)
InChI key:InChIKey=OVLXOTUWFLHWQT-UHFFFAOYSA-N
SMILES:O=C1NC=2C(O1)=CC=CN2
Synonyms:
  • 2,3-Dihydro-pyrido[2,3-d][1,3]oxazol-2-one
  • 2H,3H-[1,3]Oxazolo[4,5-b]pyridin-2-one
  • 3H-Oxazolo[4,5-b]pyridin-2-one
  • Oxazol[4,5-b]pyridine-2(3h)one
  • Oxazolo[4,5-b]pyridin-2(3H)-one
  • [1,3]Oxazolo[4,5-b]pyridin-2(3H)-one
  • [1,3]Oxazolo[4,5-b]pyridin-2-ol
Found 5 products.