CAS 609-38-1
:2-Furancarboxamide
Description:
2-Furancarboxamide, also known as furfurylamide, is an organic compound characterized by its furan ring structure with a carboxamide functional group. It is a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the amide group which can engage in hydrogen bonding. The compound has a distinct aromatic odor typical of furan derivatives. 2-Furancarboxamide is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity and ability to act as a building block in organic synthesis. It can participate in various chemical reactions, such as acylation and amidation, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, its stability under standard conditions and relatively low toxicity contribute to its utility in research and industrial applications. As with many organic compounds, proper handling and storage are essential to maintain its integrity and safety.
Formula:C5H5NO2
InChI:InChI=1S/C5H5NO2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7)
InChI key:InChIKey=TVFIYRKPCACCNL-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC=CO1
Synonyms:- 2-Furancarboxamide
- 2-Furylamide
- Furamide
- Furan-2-Carboxamide
- Furfurylamide
- NSC 9351
- 2-Furamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Furamide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H5NO2Purity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:111.10Furan-2-carboxamide
CAS:Furan-2-carboxamideFormula:C5H5NO2Purity:99%Color and Shape:SolidMolecular weight:111.098692-Furamide
CAS:Formula:C5H5NO2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:111.10Furan-2-carboxylic acid amide
CAS:Formula:C5H5NO2Purity:95%Color and Shape:SolidMolecular weight:111.1




