CAS 609-89-2
:2,4-Dichloro-6-nitrophenol
Description:
2,4-Dichloro-6-nitrophenol (CAS 609-89-2) is an organic compound characterized by its phenolic structure, which features two chlorine atoms and one nitro group attached to the aromatic ring. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in water and higher solubility in organic solvents. It exhibits a melting point that is generally in the range of typical organic compounds, indicating its solid state at room temperature. The presence of chlorine and nitro groups contributes to its reactivity, making it a useful intermediate in organic synthesis and a potential candidate for various applications, including herbicides and dyes. Additionally, 2,4-Dichloro-6-nitrophenol is of interest in environmental chemistry due to its potential toxicity and the need for careful handling and disposal. Its chemical properties, such as acidity and reactivity, are influenced by the electron-withdrawing effects of the chlorine and nitro substituents, which can affect its behavior in chemical reactions and interactions with biological systems.
Formula:C6H3Cl2NO3
InChI:InChI=1S/C6H3Cl2NO3/c7-3-1-4(8)6(10)5(2-3)9(11)12/h1-2,10H
InChI key:InChIKey=LYPMXMBQPXPNIQ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(O)C(Cl)=CC(Cl)=C1
Synonyms:- 2,4-Dichlor-6-nitrofenol
- 2,4-Dichlor-6-nitrofenol [Czech]
- 2,4-Dichloro-6-Nitrophenolate
- 2-Nitro-4,6-dichlorophenol
- 4,6-Dichloro-2-nitrophenol
- Ai3-14929
- Brn 2050081
- NSC 39606
- Nsc 38660
- Phenol, 2,4-dichloro-6-nitro-
- 2,4-Dichloro-6-nitrophenol
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,4-Dichloro-6-nitrophenol, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3Cl2NO3Purity:98+%Molecular weight:207.99Phenol, 2,4-dichloro-6-nitro-
CAS:Formula:C6H3Cl2NO3Purity:98%Color and Shape:SolidMolecular weight:207.99892,4-dichloro-6-nitrophenol
CAS:2,4-dichloro-6-nitrophenolFormula:C6H3Cl2NO3Purity:98%Molecular weight:207.998922,4-Dichloro-6-nitrophenol
CAS:Controlled ProductFormula:C6H3Cl2NO3Color and Shape:NeatMolecular weight:208.02,4-Dichloro-6-nitrophenol
CAS:2,4-Dichloro-6-nitrophenolFormula:C6H3Cl2NO3Purity:98%Molecular weight:208.02,4-Dichloro-6-nitrophenol
CAS:Formula:C6H3Cl2NO3Purity:98%Color and Shape:SolidMolecular weight:207.99





