CAS 610-16-2
:2-(Dimethylamino)benzoic acid
Description:
2-(Dimethylamino)benzoic acid, also known as DMABA, is an aromatic carboxylic acid characterized by the presence of a dimethylamino group attached to the benzene ring. This compound features a carboxylic acid functional group (-COOH) and is classified as an amino acid derivative. DMABA is typically a white to off-white crystalline solid that is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the dimethylamino group imparts basic properties, allowing it to act as a weak base. DMABA is often utilized in various applications, including pharmaceuticals, as a building block in organic synthesis, and in the development of dyes and pigments. Its chemical structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper safety protocols should be followed when working with this substance.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12)
InChI key:InChIKey=DVVXXHVHGGWWPE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N(C)C)C=CC=C1
Synonyms:- 2-(Dimethylamino)Benzoate
- 2-(Dimethylamino)benzoic acid
- 2-(N,N-Dimethylamino)benzoic acid
- Ai3-05925
- Anthranilic acid, N,N-dimethyl-
- Anthranilic acid, N,N-dimethyl- (8CI)
- Benzoic acid, 2-(dimethylamino)-
- N,N-Dimethylanthranilic acid
- Nsc 45790
- o-Dimethylaminobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Dimethylamino)benzoic Acid
CAS:Formula:C9H11NO2Purity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:165.192-(Dimethylamino)benzoic acid
CAS:Formula:C9H11NO2Purity:97%Color and Shape:SolidMolecular weight:165.18912-(Dimethylamino)benzoic acid
CAS:2-(Dimethylamino)benzoic acidFormula:C9H11NO2Purity:98%Molecular weight:165.189142-Dimethylaminobenzoic acid
CAS:2-Dimethylaminobenzoic acid (2DMB) is a chemical compound that is used as an amide. It has optical properties and can be used to study the hydrogen bond. 2DMB is also used in ultrasonic imaging and can be found in hydatid cysts, procumbens, anthranilic, proton and specific antibody. 2DMB is also used as a homogeneous catalyst for the synthesis of various chemical compounds including cancer drugs.
Formula:C9H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:165.19 g/mol2-(Dimethylamino)benzoic acid
CAS:Formula:C9H11NO2Purity:97%Color and Shape:SolidMolecular weight:165.192





