CymitQuimica logo

CAS 61034-86-4

:

[2-(1H-pyrrol-1-yl)phenyl]methanol

Description:
[2-(1H-pyrrol-1-yl)phenyl]methanol, with the CAS number 61034-86-4, is an organic compound characterized by its unique structure, which features a phenyl ring substituted with a pyrrole group and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The pyrrole moiety contributes to its potential biological activity, as pyrrole derivatives are often found in various natural products and pharmaceuticals. The compound may display moderate to high stability under standard conditions, but its reactivity can be influenced by the functional groups present. Additionally, it may participate in hydrogen bonding due to the hydroxyl group, affecting its physical properties such as boiling and melting points. Overall, [2-(1H-pyrrol-1-yl)phenyl]methanol is of interest in medicinal chemistry and materials science, where its unique structural features may lend themselves to various applications.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c13-9-10-5-1-2-6-11(10)12-7-3-4-8-12/h1-8,13H,9H2
InChI key:PMFMGYSILUCETA-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)CO)n1cccc1
Synonyms:
  • benzenemethanol, 2-(1H-pyrrol-1-yl)-
Found 3 products.