CAS 61088-39-9

1-Butanone, 1-(3,5-dimethylphenyl)-

Description:

1-Butanone, 1-(3,5-dimethylphenyl)-, also known by its CAS number 61088-39-9, is an organic compound that belongs to the class of ketones. It features a butanone backbone with a 3,5-dimethylphenyl group attached to the carbonyl carbon. This compound is characterized by its relatively low molecular weight and moderate volatility, which contributes to its use as a solvent in various chemical processes. It typically exhibits a colorless to pale yellow appearance and possesses a distinctive odor reminiscent of ketones. The presence of the aromatic ring enhances its stability and influences its reactivity, making it useful in organic synthesis and as an intermediate in the production of other chemicals. Additionally, 1-Butanone, 1-(3,5-dimethylphenyl)- may have applications in the formulation of coatings, adhesives, and other industrial products. Safety considerations include handling it in well-ventilated areas due to potential inhalation risks and skin irritation.

Formula: C₁₂H₁₆O

InChI: InChI=1S/C12H16O/c1-4-5-12(13)11-7-9(2)6-10(3)8-11/h6-8H,4-5H2,1-3H3

InChI key: MAGSUWXDMPQLFJ-UHFFFAOYSA-N

SMILES: CCCC(=O)C1=CC(=CC(=C1)C)C

1-(3,5-Dimethylphenyl)-1-butanone

CAS: 61088-39-9

1-(3,5-Dimethylphenyl)-1-butanone

Formula: C₁₂H₁₆O

Molecular weight: 176.26

Ref: 54-OR1093095