CymitQuimica logo

CAS 6109-54-2

:

Benzaldehyde, 2,5-bis(phenylmethoxy)-

Description:
Benzaldehyde, 2,5-bis(phenylmethoxy)-, also known by its CAS number 6109-54-2, is an organic compound characterized by its structure, which features a benzaldehyde moiety substituted with two phenylmethoxy groups at the 2 and 5 positions. This compound typically appears as a colorless to pale yellow liquid with a distinct aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The presence of the benzaldehyde functional group imparts reactivity, allowing it to participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the phenylmethoxy substituents enhance its stability and influence its physical properties, such as boiling point and melting point. Benzaldehyde derivatives are often utilized in organic synthesis, fragrance formulations, and as intermediates in the production of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may cause irritation to the skin and eyes.
Formula:C21H18O3
InChI:InChI=1S/C21H18O3/c22-14-19-13-20(23-15-17-7-3-1-4-8-17)11-12-21(19)24-16-18-9-5-2-6-10-18/h1-14H,15-16H2
InChI key:MPNYEOHUDBSABW-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC2=CC(=C(C=C2)OCC3=CC=CC=C3)C=O
Found 3 products.