CAS 61135-91-9: (6aR,11aR)-6a,11a-Dihydro-6H-benzofuro[3,2-c][1]benzopyran-3,9-diol

Description:(6aR,11aR)-6a,11a-Dihydro-6H-benzofuro[3,2-c][1]benzopyran-3,9-diol, with the CAS number 61135-91-9, is a chemical compound characterized by its complex polycyclic structure, which includes fused benzofuran and benzopyran rings. This compound features multiple hydroxyl (-OH) groups, contributing to its potential as a bioactive molecule. The stereochemistry indicated by the (6aR,11aR) designation suggests specific spatial arrangements of atoms, which can influence its biological activity and interactions. Generally, compounds of this nature may exhibit various pharmacological properties, including antioxidant, anti-inflammatory, or neuroprotective effects, although specific biological activities would depend on empirical studies. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings, to mitigate any potential hazards associated with exposure or reactivity.

Formula:C₁₅H₁₂O₄

InChI:InChI=1S/C15H12O4/c16-8-2-4-11-13(5-8)18-7-12-10-3-1-9(17)6-14(10)19-15(11)12/h1-6,12,15-17H,7H2/t12-,15-/m0/s1

InChI key:InChIKey=ODMIEGVTNZNSLD-WFASDCNBSA-N

SMILES:OC1=CC=C2C(OCC3C4=CC=C(O)C=C4OC23)=C1

Synonyms:
(6aR,11aR)-6a,11a-Dihydro-6H-benzofuro[3,2-c][1]benzopyran-3,9-diol
3,9-Dihydroxypterocarpan
6H-Benzofuro(3,2-c)(1)benzopyran-3,9-diol, 6a,11a-dihydro-, (6aR-cis)-
6H-Benzofuro[3,2-c][1]benzopyran-3,9-diol, 6a,11a-dihydro-, (6aR,11aR)-
Demethylmedicarpin

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3,9-Dihydroxypterocarpan REF: TM-TN2912CAS: 61135-91-9	98%	To inquire	Mon 21 Apr 25
	Demethylmedicarpin REF: 3D-XD161697CAS: 61135-91-9	Min. 95%	To inquire	Mon 28 Apr 25