CAS 6119-47-7

Quinine hydrochloride dihydrate

Description:

Quinine hydrochloride dihydrate is a chemical compound derived from the bark of the cinchona tree, primarily known for its use as an antimalarial agent. It is a white to off-white crystalline powder that is soluble in water, which facilitates its use in various pharmaceutical formulations. The compound has a bitter taste, characteristic of quinine, and is often used in tonic water and other beverages for flavoring. Quinine hydrochloride dihydrate has a molecular formula that includes both quinine and hydrochloric acid, along with two water molecules, contributing to its dihydrate classification. In addition to its antimalarial properties, it has been studied for its potential analgesic and anti-inflammatory effects. The compound acts by interfering with the parasite's ability to metabolize and utilize hemoglobin, ultimately leading to its death. Safety and dosage considerations are crucial, as excessive intake can lead to side effects such as cinchonism, characterized by symptoms like tinnitus and nausea. Overall, quinine hydrochloride dihydrate remains an important compound in both medicinal and culinary contexts.

Formula:C₂₀H₂₄N₂O₂·ClH·2H₂O

InChI:InChI=1S/C20H24N2O2.ClH.2H2O/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1H;2*1H2/t13-,14-,19-,20+;;;/m0.../s1

InChI key:InChIKey=MPQKYZPYCSTMEI-FLZPLBAKSA-N

SMILES:[C@@H](O)(C=1C2=C(C=CC(OC)=C2)N=CC1)[C@]3([N@@]4C[C@H](C=C)[C@](C3)(CC4)[H])[H].Cl.O

Synonyms:

(4beta,8alpha,9R)-6'-methoxycinchonan-9-ol hydrochloride dihydrate
(9R)-6'-methoxycinchonan-1'-ium-9-ol chloride dihydrate
(R)(6-Methoxy-4-quinolyl)(5-vinyl-1-azabicyclo[2.2.2]oct-2-yl)methanol hydrochloride
Cinchonan-9-ol, 6′-methoxy-, hydrochloride, hydrate (1:1:2), (8α,9R)-
Cinchonan-9-ol, 6′-methoxy-, monohydrochloride, dihydrate, (8α,9R)-
Quinine Hydrochloride Dihydrate